C16H18BrClN2O2 — CID 146287542
ethyl 5-(4-bromo-2-ethylphenyl)-4-chloro-1-ethylpyrazole-3-carboxylate (PubChem CID 146287542) has the molecular formula C16H18BrClN2O2 and a molecular weight of 385.69 g/mol. Its IUPAC name is ethyl 5-(4-bromo-2-ethylphenyl)-4-chloro-1-ethylpyrazole-3-carboxylate.
| Compound Name | ethyl 5-(4-bromo-2-ethylphenyl)-4-chloro-1-ethylpyrazole-3-carboxylate |
|---|---|
| PubChem CID | 146287542 |
| Molecular Formula | C16H18BrClN2O2 |
| Molecular Weight | 385.69 g/mol |
| Exact Mass | 384.02 |
| IUPAC Name | ethyl 5-(4-bromo-2-ethylphenyl)-4-chloro-1-ethylpyrazole-3-carboxylate |
| SMILES | CCOC(=O)c1nn(CC)c(-c2ccc(Br)cc2CC)c1Cl |
| InChI | InChI=1S/C16H18BrClN2O2/c1-4-10-9-11(17)7-8-12(10)15-13(18)14(16(21)22-6-3)19-20(15)5-2/h7-9H,4-6H2,1-3H3 |
| InChIKey | LMQJPSPXQUYXLI-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.69 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |