C16H20ClN3O2 — CID 146285786
ethyl 4-chloro-1-ethyl-5-(4-propan-2-yl-3-pyridinyl)pyrazole-3-carboxylate (PubChem CID 146285786) has the molecular formula C16H20ClN3O2 and a molecular weight of 321.81 g/mol. Its IUPAC name is ethyl 4-chloro-1-ethyl-5-(4-propan-2-yl-3-pyridinyl)pyrazole-3-carboxylate.
| Compound Name | ethyl 4-chloro-1-ethyl-5-(4-propan-2-yl-3-pyridinyl)pyrazole-3-carboxylate |
|---|---|
| PubChem CID | 146285786 |
| Molecular Formula | C16H20ClN3O2 |
| Molecular Weight | 321.81 g/mol |
| Exact Mass | 321.12 |
| IUPAC Name | ethyl 4-chloro-1-ethyl-5-(4-propan-2-yl-3-pyridinyl)pyrazole-3-carboxylate |
| SMILES | CCOC(=O)c1nn(CC)c(-c2cnccc2C(C)C)c1Cl |
| InChI | InChI=1S/C16H20ClN3O2/c1-5-20-15(12-9-18-8-7-11(12)10(3)4)13(17)14(19-20)16(21)22-6-2/h7-10H,5-6H2,1-4H3 |
| InChIKey | GMWYTSZJHOSZBM-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 57.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.81 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |