C18H15ClF8N2O4 — CID 146287565
ethyl 4-chloro-5-[2-(difluoromethoxy)-4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-1-ethylpyrazole-3-carboxylate (PubChem CID 146287565) has the molecular formula C18H15ClF8N2O4 and a molecular weight of 510.77 g/mol. Its IUPAC name is ethyl 4-chloro-5-[2-(difluoromethoxy)-4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-1-ethylpyrazole-3-carboxylate.
| Compound Name | ethyl 4-chloro-5-[2-(difluoromethoxy)-4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-1-ethylpyrazole-3-carboxylate |
|---|---|
| PubChem CID | 146287565 |
| Molecular Formula | C18H15ClF8N2O4 |
| Molecular Weight | 510.77 g/mol |
| Exact Mass | 510.06 |
| IUPAC Name | ethyl 4-chloro-5-[2-(difluoromethoxy)-4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-1-ethylpyrazole-3-carboxylate |
| SMILES | CCOC(=O)c1nn(CC)c(-c2ccc(C(O)(C(F)(F)F)C(F)(F)F)cc2OC(F)F)c1Cl |
| InChI | InChI=1S/C18H15ClF8N2O4/c1-3-29-13(11(19)12(28-29)14(30)32-4-2)9-6-5-8(7-10(9)33-15(20)21)16(31,17(22,23)24)18(25,26)27/h5-7,15,31H,3-4H2,1-2H3 |
| InChIKey | PQNRJGKBMKYLSR-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.77 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |