C24H26ClF8N3O5S — CID 146287330
4-chloro-5-[2-(difluoromethoxy)-4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-1-ethyl-N-[(4-methylsulfonylcyclohexyl)methyl]pyrazole-3-carboxamide (PubChem CID 146287330) has the molecular formula C24H26ClF8N3O5S and a molecular weight of 655.99 g/mol. Its IUPAC name is 4-chloro-5-[2-(difluoromethoxy)-4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-1-ethyl-N-[(4-methylsulfonylcyclohexyl)methyl]pyrazole-3-carboxamide.
| Compound Name | 4-chloro-5-[2-(difluoromethoxy)-4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-1-ethyl-N-[(4-methylsulfonylcyclohexyl)methyl]pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 146287330 |
| Molecular Formula | C24H26ClF8N3O5S |
| Molecular Weight | 655.99 g/mol |
| Exact Mass | 655.12 |
| IUPAC Name | 4-chloro-5-[2-(difluoromethoxy)-4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-1-ethyl-N-[(4-methylsulfonylcyclohexyl)methyl]pyrazole-3-carboxamide |
| SMILES | CCn1nc(C(=O)NCC2CCC(S(C)(=O)=O)CC2)c(Cl)c1-c1ccc(C(O)(C(F)(F)F)C(F)(F)F)cc1OC(F)F |
| InChI | InChI=1S/C24H26ClF8N3O5S/c1-3-36-19(17(25)18(35-36)20(37)34-11-12-4-7-14(8-5-12)42(2,39)40)15-9-6-13(10-16(15)41-21(26)27)22(38,23(28,29)30)24(31,32)33/h6,9-10,12,14,21,38H,3-5,7-8,11H2,1-2H3,(H,34,37) |
| InChIKey | PTZBFMAVQCUYMR-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 110.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 655.99 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |