C16H20ClN3O3 — CID 146279751
ethyl 4-chloro-1-ethyl-5-(1-oxido-4-propan-2-ylpyridin-1-ium-3-yl)pyrazole-3-carboxylate (PubChem CID 146279751) has the molecular formula C16H20ClN3O3 and a molecular weight of 337.81 g/mol. Its IUPAC name is ethyl 4-chloro-1-ethyl-5-(1-oxido-4-propan-2-ylpyridin-1-ium-3-yl)pyrazole-3-carboxylate.
| Compound Name | ethyl 4-chloro-1-ethyl-5-(1-oxido-4-propan-2-ylpyridin-1-ium-3-yl)pyrazole-3-carboxylate |
|---|---|
| PubChem CID | 146279751 |
| Molecular Formula | C16H20ClN3O3 |
| Molecular Weight | 337.81 g/mol |
| Exact Mass | 337.12 |
| IUPAC Name | ethyl 4-chloro-1-ethyl-5-(1-oxido-4-propan-2-ylpyridin-1-ium-3-yl)pyrazole-3-carboxylate |
| SMILES | CCOC(=O)c1nn(CC)c(-c2c[n+]([O-])ccc2C(C)C)c1Cl |
| InChI | InChI=1S/C16H20ClN3O3/c1-5-20-15(13(17)14(18-20)16(21)23-6-2)12-9-19(22)8-7-11(12)10(3)4/h7-10H,5-6H2,1-4H3 |
| InChIKey | HDQJRCDUFRZQGJ-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.81 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|