C9H12N4S2 — CID 23007194
5-(5-butyl-1H-pyrazol-3-yl)-3H-1,3,4-thiadiazole-2-thione (PubChem CID 23007194) has the molecular formula C9H12N4S2 and a molecular weight of 240.36 g/mol. Its IUPAC name is 5-(5-butyl-1H-pyrazol-3-yl)-3H-1,3,4-thiadiazole-2-thione.
| Compound Name | 5-(5-butyl-1H-pyrazol-3-yl)-3H-1,3,4-thiadiazole-2-thione |
|---|---|
| PubChem CID | 23007194 |
| Molecular Formula | C9H12N4S2 |
| Molecular Weight | 240.36 g/mol |
| Exact Mass | 240.05 |
| IUPAC Name | 5-(5-butyl-1H-pyrazol-3-yl)-3H-1,3,4-thiadiazole-2-thione |
| SMILES | CCCCc1cc(-c2n[nH]c(=S)s2)n[nH]1 |
| InChI | InChI=1S/C9H12N4S2/c1-2-3-4-6-5-7(11-10-6)8-12-13-9(14)15-8/h5H,2-4H2,1H3,(H,10,11)(H,13,14) |
| InChIKey | PNVXLJRCRLHPAP-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 57.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.36 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|