C9H11F3N4S4 — CID 160773534
5-butyl-3H-1,3,4-thiadiazole-2-thione;5-(trifluoromethyl)-3H-1,3,4-thiadiazole-2-thione (PubChem CID 160773534) has the molecular formula C9H11F3N4S4 and a molecular weight of 360.48 g/mol. Its IUPAC name is 5-butyl-3H-1,3,4-thiadiazole-2-thione;5-(trifluoromethyl)-3H-1,3,4-thiadiazole-2-thione.
| Compound Name | 5-butyl-3H-1,3,4-thiadiazole-2-thione;5-(trifluoromethyl)-3H-1,3,4-thiadiazole-2-thione |
|---|---|
| PubChem CID | 160773534 |
| Molecular Formula | C9H11F3N4S4 |
| Molecular Weight | 360.48 g/mol |
| Exact Mass | 359.98 |
| IUPAC Name | 5-butyl-3H-1,3,4-thiadiazole-2-thione;5-(trifluoromethyl)-3H-1,3,4-thiadiazole-2-thione |
| SMILES | CCCCc1n[nH]c(=S)s1.FC(F)(F)c1n[nH]c(=S)s1 |
| InChI | InChI=1S/C6H10N2S2.C3HF3N2S2/c1-2-3-4-5-7-8-6(9)10-5;4-3(5,6)1-7-8-2(9)10-1/h2-4H2,1H3,(H,8,9);(H,8,9) |
| InChIKey | RZQFRWSVGAFTKE-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 57.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.48 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|