C16H22N2OS3 — CID 126602394
5-(1-hydroxy-1-phenyloctyl)sulfanyl-3H-1,3,4-thiadiazole-2-thione (PubChem CID 126602394) has the molecular formula C16H22N2OS3 and a molecular weight of 354.57 g/mol. Its IUPAC name is 5-(1-hydroxy-1-phenyloctyl)sulfanyl-3H-1,3,4-thiadiazole-2-thione.
| Compound Name | 5-(1-hydroxy-1-phenyloctyl)sulfanyl-3H-1,3,4-thiadiazole-2-thione |
|---|---|
| PubChem CID | 126602394 |
| Molecular Formula | C16H22N2OS3 |
| Molecular Weight | 354.57 g/mol |
| Exact Mass | 354.09 |
| IUPAC Name | 5-(1-hydroxy-1-phenyloctyl)sulfanyl-3H-1,3,4-thiadiazole-2-thione |
| SMILES | CCCCCCCC(O)(Sc1n[nH]c(=S)s1)c1ccccc1 |
| InChI | InChI=1S/C16H22N2OS3/c1-2-3-4-5-9-12-16(19,13-10-7-6-8-11-13)22-15-18-17-14(20)21-15/h6-8,10-11,19H,2-5,9,12H2,1H3,(H,17,20) |
| InChIKey | CFXSILJYEXRHIF-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 48.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.57 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|