C11H20N2S2 — CID 86172574
5-nonan-5-yl-3H-1,3,4-thiadiazole-2-thione (PubChem CID 86172574) has the molecular formula C11H20N2S2 and a molecular weight of 244.43 g/mol. Its IUPAC name is 5-nonan-5-yl-3H-1,3,4-thiadiazole-2-thione.
| Compound Name | 5-nonan-5-yl-3H-1,3,4-thiadiazole-2-thione |
|---|---|
| PubChem CID | 86172574 |
| Molecular Formula | C11H20N2S2 |
| Molecular Weight | 244.43 g/mol |
| Exact Mass | 244.11 |
| IUPAC Name | 5-nonan-5-yl-3H-1,3,4-thiadiazole-2-thione |
| SMILES | CCCCC(CCCC)c1n[nH]c(=S)s1 |
| InChI | InChI=1S/C11H20N2S2/c1-3-5-7-9(8-6-4-2)10-12-13-11(14)15-10/h9H,3-8H2,1-2H3,(H,13,14) |
| InChIKey | AMZZDUSGPVBLAY-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.43 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|