C11H12N2OS2 — CID 20652932
5-[1-(4-methylphenoxy)ethyl]-3H-1,3,4-thiadiazole-2-thione (PubChem CID 20652932) has the molecular formula C11H12N2OS2 and a molecular weight of 252.36 g/mol. Its IUPAC name is 5-[1-(4-methylphenoxy)ethyl]-3H-1,3,4-thiadiazole-2-thione.
| Compound Name | 5-[1-(4-methylphenoxy)ethyl]-3H-1,3,4-thiadiazole-2-thione |
|---|---|
| PubChem CID | 20652932 |
| Molecular Formula | C11H12N2OS2 |
| Molecular Weight | 252.36 g/mol |
| Exact Mass | 252.04 |
| IUPAC Name | 5-[1-(4-methylphenoxy)ethyl]-3H-1,3,4-thiadiazole-2-thione |
| SMILES | Cc1ccc(OC(C)c2n[nH]c(=S)s2)cc1 |
| InChI | InChI=1S/C11H12N2OS2/c1-7-3-5-9(6-4-7)14-8(2)10-12-13-11(15)16-10/h3-6,8H,1-2H3,(H,13,15) |
| InChIKey | DUYLDGWGUKKENE-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 37.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.36 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|