C10H10ClN3OS — CID 3155972
5-[1-(4-chlorophenoxy)ethyl]-1,3,4-thiadiazol-2-amine (PubChem CID 3155972) has the molecular formula C10H10ClN3OS and a molecular weight of 255.73 g/mol. Its IUPAC name is 5-[1-(4-chlorophenoxy)ethyl]-1,3,4-thiadiazol-2-amine.
| Compound Name | 5-[1-(4-chlorophenoxy)ethyl]-1,3,4-thiadiazol-2-amine |
|---|---|
| PubChem CID | 3155972 |
| Molecular Formula | C10H10ClN3OS |
| Molecular Weight | 255.73 g/mol |
| Exact Mass | 255.02 |
| IUPAC Name | 5-[1-(4-chlorophenoxy)ethyl]-1,3,4-thiadiazol-2-amine |
| SMILES | CC(Oc1ccc(Cl)cc1)c1nnc(N)s1 |
| InChI | InChI=1S/C10H10ClN3OS/c1-6(9-13-14-10(12)16-9)15-8-4-2-7(11)3-5-8/h2-6H,1H3,(H2,12,14) |
| InChIKey | HTYDEDHDFUUPIN-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 61.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.73 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |