C11H7Cl2N3O2S — CID 54545133
2-[1-(3,5-dichlorophenoxy)ethyl]-5-isocyanato-1,3,4-thiadiazole (PubChem CID 54545133) has the molecular formula C11H7Cl2N3O2S and a molecular weight of 316.17 g/mol. Its IUPAC name is 2-[1-(3,5-dichlorophenoxy)ethyl]-5-isocyanato-1,3,4-thiadiazole.
| Compound Name | 2-[1-(3,5-dichlorophenoxy)ethyl]-5-isocyanato-1,3,4-thiadiazole |
|---|---|
| PubChem CID | 54545133 |
| Molecular Formula | C11H7Cl2N3O2S |
| Molecular Weight | 316.17 g/mol |
| Exact Mass | 314.96 |
| IUPAC Name | 2-[1-(3,5-dichlorophenoxy)ethyl]-5-isocyanato-1,3,4-thiadiazole |
| SMILES | CC(Oc1cc(Cl)cc(Cl)c1)c1nnc(N=C=O)s1 |
| InChI | InChI=1S/C11H7Cl2N3O2S/c1-6(10-15-16-11(19-10)14-5-17)18-9-3-7(12)2-8(13)4-9/h2-4,6H,1H3 |
| InChIKey | ZFZNLLMVGAEZMS-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 64.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.17 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|