C10H10N2S3 — CID 165353209
5-(2,4-dimethylphenyl)sulfanyl-3H-1,3,4-thiadiazole-2-thione (PubChem CID 165353209) has the molecular formula C10H10N2S3 and a molecular weight of 254.41 g/mol. Its IUPAC name is 5-(2,4-dimethylphenyl)sulfanyl-3H-1,3,4-thiadiazole-2-thione.
| Compound Name | 5-(2,4-dimethylphenyl)sulfanyl-3H-1,3,4-thiadiazole-2-thione |
|---|---|
| PubChem CID | 165353209 |
| Molecular Formula | C10H10N2S3 |
| Molecular Weight | 254.41 g/mol |
| Exact Mass | 254.00 |
| IUPAC Name | 5-(2,4-dimethylphenyl)sulfanyl-3H-1,3,4-thiadiazole-2-thione |
| SMILES | Cc1ccc(Sc2n[nH]c(=S)s2)c(C)c1 |
| InChI | InChI=1S/C10H10N2S3/c1-6-3-4-8(7(2)5-6)14-10-12-11-9(13)15-10/h3-5H,1-2H3,(H,11,13) |
| InChIKey | ISIOTLFWROWBSM-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.41 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|