C3H4AgN2S2+ — CID 18620396
silver 5-methyl-3H-1,3,4-thiadiazole-2-thione (PubChem CID 18620396) has the molecular formula C3H4AgN2S2+ and a molecular weight of 240.08 g/mol. Its IUPAC name is silver 5-methyl-3H-1,3,4-thiadiazole-2-thione.
| Compound Name | silver 5-methyl-3H-1,3,4-thiadiazole-2-thione |
|---|---|
| PubChem CID | 18620396 |
| Molecular Formula | C3H4AgN2S2+ |
| Molecular Weight | 240.08 g/mol |
| Exact Mass | 238.89 |
| IUPAC Name | silver 5-methyl-3H-1,3,4-thiadiazole-2-thione |
| SMILES | Cc1n[nH]c(=S)s1.[Ag+] |
| InChI | InChI=1S/C3H4N2S2.Ag/c1-2-4-5-3(6)7-2;/h1H3,(H,5,6);/q;+1 |
| InChIKey | QLEYNCHNBCOFBA-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.08 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|