C24H29N3O2S2 — CID 91292210
N,N-dimethyl-7-oxo-7-(4-phenylphenyl)heptanamide;5-methyl-3H-1,3,4-thiadiazole-2-thione (PubChem CID 91292210) has the molecular formula C24H29N3O2S2 and a molecular weight of 455.65 g/mol. Its IUPAC name is N,N-dimethyl-7-oxo-7-(4-phenylphenyl)heptanamide;5-methyl-3H-1,3,4-thiadiazole-2-thione.
| Compound Name | N,N-dimethyl-7-oxo-7-(4-phenylphenyl)heptanamide;5-methyl-3H-1,3,4-thiadiazole-2-thione |
|---|---|
| PubChem CID | 91292210 |
| Molecular Formula | C24H29N3O2S2 |
| Molecular Weight | 455.65 g/mol |
| Exact Mass | 455.17 |
| IUPAC Name | N,N-dimethyl-7-oxo-7-(4-phenylphenyl)heptanamide;5-methyl-3H-1,3,4-thiadiazole-2-thione |
| SMILES | CN(C)C(=O)CCCCCC(=O)c1ccc(-c2ccccc2)cc1.Cc1n[nH]c(=S)s1 |
| InChI | InChI=1S/C21H25NO2.C3H4N2S2/c1-22(2)21(24)12-8-4-7-11-20(23)19-15-13-18(14-16-19)17-9-5-3-6-10-17;1-2-4-5-3(6)7-2/h3,5-6,9-10,13-16H,4,7-8,11-12H2,1-2H3;1H3,(H,5,6) |
| InChIKey | UKEYZQSLCCUNML-UHFFFAOYSA-N |
| XLogP | 6.08 |
| TPSA | 66.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.65 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|