C29H30N2O — CID 157112525
4-(dimethylamino)-1-[4-[1-(2-methylphenyl)-5-phenylpyrrol-2-yl]phenyl]butan-1-one (PubChem CID 157112525) has the molecular formula C29H30N2O and a molecular weight of 422.57 g/mol. Its IUPAC name is 4-(dimethylamino)-1-[4-[1-(2-methylphenyl)-5-phenylpyrrol-2-yl]phenyl]butan-1-one.
| Compound Name | 4-(dimethylamino)-1-[4-[1-(2-methylphenyl)-5-phenylpyrrol-2-yl]phenyl]butan-1-one |
|---|---|
| PubChem CID | 157112525 |
| Molecular Formula | C29H30N2O |
| Molecular Weight | 422.57 g/mol |
| Exact Mass | 422.24 |
| IUPAC Name | 4-(dimethylamino)-1-[4-[1-(2-methylphenyl)-5-phenylpyrrol-2-yl]phenyl]butan-1-one |
| SMILES | Cc1ccccc1-n1c(-c2ccccc2)ccc1-c1ccc(C(=O)CCCN(C)C)cc1 |
| InChI | InChI=1S/C29H30N2O/c1-22-10-7-8-13-26(22)31-27(23-11-5-4-6-12-23)19-20-28(31)24-15-17-25(18-16-24)29(32)14-9-21-30(2)3/h4-8,10-13,15-20H,9,14,21H2,1-3H3 |
| InChIKey | AHADUQXISNEOBG-UHFFFAOYSA-N |
| XLogP | 6.64 |
| TPSA | 25.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.57 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |