C20H17FNO2- — CID 3638718
3-[5-(4-fluorophenyl)-1-(2-methylphenyl)pyrrol-2-yl]propanoate (PubChem CID 3638718) has the molecular formula C20H17FNO2- and a molecular weight of 322.36 g/mol. Its IUPAC name is 3-[5-(4-fluorophenyl)-1-(2-methylphenyl)pyrrol-2-yl]propanoate.
| Compound Name | 3-[5-(4-fluorophenyl)-1-(2-methylphenyl)pyrrol-2-yl]propanoate |
|---|---|
| PubChem CID | 3638718 |
| Molecular Formula | C20H17FNO2- |
| Molecular Weight | 322.36 g/mol |
| Exact Mass | 322.12 |
| IUPAC Name | 3-[5-(4-fluorophenyl)-1-(2-methylphenyl)pyrrol-2-yl]propanoate |
| SMILES | Cc1ccccc1-n1c(CCC(=O)[O-])ccc1-c1ccc(F)cc1 |
| InChI | InChI=1S/C20H18FNO2/c1-14-4-2-3-5-18(14)22-17(11-13-20(23)24)10-12-19(22)15-6-8-16(21)9-7-15/h2-10,12H,11,13H2,1H3,(H,23,24)/p-1 |
| InChIKey | SECJJYFWXGKHDG-UHFFFAOYSA-M |
| XLogP | 3.27 |
| TPSA | 45.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.36 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'pyrrole_B(29)', 'substructure': 'N/A'} |
|---|