C19H14BrFNO2- — CID 6980216
3-[1-(3-bromophenyl)-5-(4-fluorophenyl)pyrrol-2-yl]propanoate (PubChem CID 6980216) has the molecular formula C19H14BrFNO2- and a molecular weight of 387.23 g/mol. Its IUPAC name is 3-[1-(3-bromophenyl)-5-(4-fluorophenyl)pyrrol-2-yl]propanoate.
| Compound Name | 3-[1-(3-bromophenyl)-5-(4-fluorophenyl)pyrrol-2-yl]propanoate |
|---|---|
| PubChem CID | 6980216 |
| Molecular Formula | C19H14BrFNO2- |
| Molecular Weight | 387.23 g/mol |
| Exact Mass | 386.02 |
| IUPAC Name | 3-[1-(3-bromophenyl)-5-(4-fluorophenyl)pyrrol-2-yl]propanoate |
| SMILES | O=C([O-])CCc1ccc(-c2ccc(F)cc2)n1-c1cccc(Br)c1 |
| InChI | InChI=1S/C19H15BrFNO2/c20-14-2-1-3-17(12-14)22-16(9-11-19(23)24)8-10-18(22)13-4-6-15(21)7-5-13/h1-8,10,12H,9,11H2,(H,23,24)/p-1 |
| InChIKey | BZIYMRZMIRQVMD-UHFFFAOYSA-M |
| XLogP | 3.73 |
| TPSA | 45.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.23 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'pyrrole_B(29)', 'substructure': 'N/A'} |
|---|