C21H17NO4-2 — CID 4642881
4-[2-(2-carboxylatoethyl)-5-(4-methylphenyl)pyrrol-1-yl]benzoate (PubChem CID 4642881) has the molecular formula C21H17NO4-2 and a molecular weight of 347.37 g/mol. Its IUPAC name is 4-[2-(2-carboxylatoethyl)-5-(4-methylphenyl)pyrrol-1-yl]benzoate.
| Compound Name | 4-[2-(2-carboxylatoethyl)-5-(4-methylphenyl)pyrrol-1-yl]benzoate |
|---|---|
| PubChem CID | 4642881 |
| Molecular Formula | C21H17NO4-2 |
| Molecular Weight | 347.37 g/mol |
| Exact Mass | 347.12 |
| IUPAC Name | 4-[2-(2-carboxylatoethyl)-5-(4-methylphenyl)pyrrol-1-yl]benzoate |
| SMILES | Cc1ccc(-c2ccc(CCC(=O)[O-])n2-c2ccc(C(=O)[O-])cc2)cc1 |
| InChI | InChI=1S/C21H19NO4/c1-14-2-4-15(5-3-14)19-12-10-18(11-13-20(23)24)22(19)17-8-6-16(7-9-17)21(25)26/h2-10,12H,11,13H2,1H3,(H,23,24)(H,25,26)/p-2 |
| InChIKey | NXNMRMWZQDVZGA-UHFFFAOYSA-L |
| XLogP | 1.50 |
| TPSA | 85.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.37 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'pyrrole_B(29)', 'substructure': 'N/A'} |
|---|