C34H39ClN2O — CID 161445580
1-[4-[5-(4-chlorophenyl)-1-[2-methyl-5-(2-methylpropyl)phenyl]pyrrol-2-yl]phenyl]-5-(dimethylamino)pentan-1-one (PubChem CID 161445580) has the molecular formula C34H39ClN2O and a molecular weight of 527.15 g/mol. Its IUPAC name is 1-[4-[5-(4-chlorophenyl)-1-[2-methyl-5-(2-methylpropyl)phenyl]pyrrol-2-yl]phenyl]-5-(dimethylamino)pentan-1-one.
| Compound Name | 1-[4-[5-(4-chlorophenyl)-1-[2-methyl-5-(2-methylpropyl)phenyl]pyrrol-2-yl]phenyl]-5-(dimethylamino)pentan-1-one |
|---|---|
| PubChem CID | 161445580 |
| Molecular Formula | C34H39ClN2O |
| Molecular Weight | 527.15 g/mol |
| Exact Mass | 526.28 |
| IUPAC Name | 1-[4-[5-(4-chlorophenyl)-1-[2-methyl-5-(2-methylpropyl)phenyl]pyrrol-2-yl]phenyl]-5-(dimethylamino)pentan-1-one |
| SMILES | Cc1ccc(CC(C)C)cc1-n1c(-c2ccc(Cl)cc2)ccc1-c1ccc(C(=O)CCCCN(C)C)cc1 |
| InChI | InChI=1S/C34H39ClN2O/c1-24(2)22-26-10-9-25(3)33(23-26)37-31(19-20-32(37)28-15-17-30(35)18-16-28)27-11-13-29(14-12-27)34(38)8-6-7-21-36(4)5/h9-20,23-24H,6-8,21-22H2,1-5H3 |
| InChIKey | VZVSIQHQBKHPIE-UHFFFAOYSA-N |
| XLogP | 8.89 |
| TPSA | 25.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.15 |
| LogP ≤ 5 | 8.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|