C29H27BrF3N3O — CID 142461464
4-[5-(4-bromophenyl)-1-[2-(trifluoromethyl)phenyl]pyrrol-2-yl]-N-[3-(dimethylamino)propyl]benzamide (PubChem CID 142461464) has the molecular formula C29H27BrF3N3O and a molecular weight of 570.45 g/mol. Its IUPAC name is 4-[5-(4-bromophenyl)-1-[2-(trifluoromethyl)phenyl]pyrrol-2-yl]-N-[3-(dimethylamino)propyl]benzamide.
| Compound Name | 4-[5-(4-bromophenyl)-1-[2-(trifluoromethyl)phenyl]pyrrol-2-yl]-N-[3-(dimethylamino)propyl]benzamide |
|---|---|
| PubChem CID | 142461464 |
| Molecular Formula | C29H27BrF3N3O |
| Molecular Weight | 570.45 g/mol |
| Exact Mass | 569.13 |
| IUPAC Name | 4-[5-(4-bromophenyl)-1-[2-(trifluoromethyl)phenyl]pyrrol-2-yl]-N-[3-(dimethylamino)propyl]benzamide |
| SMILES | CN(C)CCCNC(=O)c1ccc(-c2ccc(-c3ccc(Br)cc3)n2-c2ccccc2C(F)(F)F)cc1 |
| InChI | InChI=1S/C29H27BrF3N3O/c1-35(2)19-5-18-34-28(37)22-10-8-20(9-11-22)25-16-17-26(21-12-14-23(30)15-13-21)36(25)27-7-4-3-6-24(27)29(31,32)33/h3-4,6-17H,5,18-19H2,1-2H3,(H,34,37) |
| InChIKey | NIWZSYKSOIAXAR-UHFFFAOYSA-N |
| XLogP | 7.27 |
| TPSA | 37.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.45 |
| LogP ≤ 5 | 7.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|