C23H16BrF3N2S — CID 142461505
S-[4-[5-(4-bromophenyl)-1-[2-(trifluoromethyl)phenyl]pyrrol-2-yl]phenyl]thiohydroxylamine (PubChem CID 142461505) has the molecular formula C23H16BrF3N2S and a molecular weight of 489.36 g/mol. Its IUPAC name is S-[4-[5-(4-bromophenyl)-1-[2-(trifluoromethyl)phenyl]pyrrol-2-yl]phenyl]thiohydroxylamine.
| Compound Name | S-[4-[5-(4-bromophenyl)-1-[2-(trifluoromethyl)phenyl]pyrrol-2-yl]phenyl]thiohydroxylamine |
|---|---|
| PubChem CID | 142461505 |
| Molecular Formula | C23H16BrF3N2S |
| Molecular Weight | 489.36 g/mol |
| Exact Mass | 488.02 |
| IUPAC Name | S-[4-[5-(4-bromophenyl)-1-[2-(trifluoromethyl)phenyl]pyrrol-2-yl]phenyl]thiohydroxylamine |
| SMILES | NSc1ccc(-c2ccc(-c3ccc(Br)cc3)n2-c2ccccc2C(F)(F)F)cc1 |
| InChI | InChI=1S/C23H16BrF3N2S/c24-17-9-5-15(6-10-17)20-13-14-21(16-7-11-18(30-28)12-8-16)29(20)22-4-2-1-3-19(22)23(25,26)27/h1-14H,28H2 |
| InChIKey | IKDRNSZJGSTURK-UHFFFAOYSA-N |
| XLogP | 7.56 |
| TPSA | 30.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.36 |
| LogP ≤ 5 | 7.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|