C28H30F3N3O — CID 156711065
N-[3-(dimethylamino)propyl]-4-[5-[(3E)-penta-1,3-dien-3-yl]-1-[2-(trifluoromethyl)phenyl]pyrrol-2-yl]benzamide (PubChem CID 156711065) has the molecular formula C28H30F3N3O and a molecular weight of 481.56 g/mol. Its IUPAC name is N-[3-(dimethylamino)propyl]-4-[5-[(3E)-penta-1,3-dien-3-yl]-1-[2-(trifluoromethyl)phenyl]pyrrol-2-yl]benzamide.
| Compound Name | N-[3-(dimethylamino)propyl]-4-[5-[(3E)-penta-1,3-dien-3-yl]-1-[2-(trifluoromethyl)phenyl]pyrrol-2-yl]benzamide |
|---|---|
| PubChem CID | 156711065 |
| Molecular Formula | C28H30F3N3O |
| Molecular Weight | 481.56 g/mol |
| Exact Mass | 481.23 |
| IUPAC Name | N-[3-(dimethylamino)propyl]-4-[5-[(3E)-penta-1,3-dien-3-yl]-1-[2-(trifluoromethyl)phenyl]pyrrol-2-yl]benzamide |
| SMILES | C=C/C(=C\C)c1ccc(-c2ccc(C(=O)NCCCN(C)C)cc2)n1-c1ccccc1C(F)(F)F |
| InChI | InChI=1S/C28H30F3N3O/c1-5-20(6-2)24-16-17-25(34(24)26-11-8-7-10-23(26)28(29,30)31)21-12-14-22(15-13-21)27(35)32-18-9-19-33(3)4/h5-8,10-17H,1,9,18-19H2,2-4H3,(H,32,35)/b20-6+ |
| InChIKey | AOLKJKMAYRJJDN-CGOBSMCZSA-N |
| XLogP | 6.43 |
| TPSA | 37.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.56 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|