C28H30BrN3 — CID 158154455
N-[[3-[5-(4-bromophenyl)-1-(2-methylphenyl)pyrrol-2-yl]phenyl]methyl]-N',N'-dimethylethane-1,2-diamine (PubChem CID 158154455) has the molecular formula C28H30BrN3 and a molecular weight of 488.47 g/mol. Its IUPAC name is N-[[3-[5-(4-bromophenyl)-1-(2-methylphenyl)pyrrol-2-yl]phenyl]methyl]-N',N'-dimethylethane-1,2-diamine.
| Compound Name | N-[[3-[5-(4-bromophenyl)-1-(2-methylphenyl)pyrrol-2-yl]phenyl]methyl]-N',N'-dimethylethane-1,2-diamine |
|---|---|
| PubChem CID | 158154455 |
| Molecular Formula | C28H30BrN3 |
| Molecular Weight | 488.47 g/mol |
| Exact Mass | 487.16 |
| IUPAC Name | N-[[3-[5-(4-bromophenyl)-1-(2-methylphenyl)pyrrol-2-yl]phenyl]methyl]-N',N'-dimethylethane-1,2-diamine |
| SMILES | Cc1ccccc1-n1c(-c2ccc(Br)cc2)ccc1-c1cccc(CNCCN(C)C)c1 |
| InChI | InChI=1S/C28H30BrN3/c1-21-7-4-5-10-26(21)32-27(23-11-13-25(29)14-12-23)15-16-28(32)24-9-6-8-22(19-24)20-30-17-18-31(2)3/h4-16,19,30H,17-18,20H2,1-3H3 |
| InChIKey | FVMVRDCBBSHEPK-UHFFFAOYSA-N |
| XLogP | 6.53 |
| TPSA | 20.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.47 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|