C6H8N4OS3 — CID 142209790
5-methyl-3H-1,3,4-oxadiazole-2-thione;5-methyl-3H-1,3,4-thiadiazole-2-thione (PubChem CID 142209790) has the molecular formula C6H8N4OS3 and a molecular weight of 248.36 g/mol. Its IUPAC name is 5-methyl-3H-1,3,4-oxadiazole-2-thione;5-methyl-3H-1,3,4-thiadiazole-2-thione.
| Compound Name | 5-methyl-3H-1,3,4-oxadiazole-2-thione;5-methyl-3H-1,3,4-thiadiazole-2-thione |
|---|---|
| PubChem CID | 142209790 |
| Molecular Formula | C6H8N4OS3 |
| Molecular Weight | 248.36 g/mol |
| Exact Mass | 247.99 |
| IUPAC Name | 5-methyl-3H-1,3,4-oxadiazole-2-thione;5-methyl-3H-1,3,4-thiadiazole-2-thione |
| SMILES | Cc1n[nH]c(=S)o1.Cc1n[nH]c(=S)s1 |
| InChI | InChI=1S/C3H4N2OS.C3H4N2S2/c1-2-4-5-3(7)6-2;1-2-4-5-3(6)7-2/h1H3,(H,5,7);1H3,(H,5,6) |
| InChIKey | JLYNSSJYZITGFQ-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 70.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.36 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|