C5H7N5S4 — CID 158096921
5-amino-3H-1,3,4-thiadiazole-2-thione;5-methyl-3H-1,3,4-thiadiazole-2-thione (PubChem CID 158096921) has the molecular formula C5H7N5S4 and a molecular weight of 265.41 g/mol. Its IUPAC name is 5-amino-3H-1,3,4-thiadiazole-2-thione;5-methyl-3H-1,3,4-thiadiazole-2-thione.
| Compound Name | 5-amino-3H-1,3,4-thiadiazole-2-thione;5-methyl-3H-1,3,4-thiadiazole-2-thione |
|---|---|
| PubChem CID | 158096921 |
| Molecular Formula | C5H7N5S4 |
| Molecular Weight | 265.41 g/mol |
| Exact Mass | 264.96 |
| IUPAC Name | 5-amino-3H-1,3,4-thiadiazole-2-thione;5-methyl-3H-1,3,4-thiadiazole-2-thione |
| SMILES | Cc1n[nH]c(=S)s1.Nc1n[nH]c(=S)s1 |
| InChI | InChI=1S/C3H4N2S2.C2H3N3S2/c1-2-4-5-3(6)7-2;3-1-4-5-2(6)7-1/h1H3,(H,5,6);(H2,3,4)(H,5,6) |
| InChIKey | FOTXCERPMACRDT-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 83.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.41 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|