C13H16N2O2S3 — CID 70473360
ethyl 5-[5-(2-sulfanylidene-3H-1,3,4-thiadiazol-5-yl)thiophen-2-yl]pentanoate (PubChem CID 70473360) has the molecular formula C13H16N2O2S3 and a molecular weight of 328.48 g/mol. Its IUPAC name is ethyl 5-[5-(2-sulfanylidene-3H-1,3,4-thiadiazol-5-yl)thiophen-2-yl]pentanoate.
| Compound Name | ethyl 5-[5-(2-sulfanylidene-3H-1,3,4-thiadiazol-5-yl)thiophen-2-yl]pentanoate |
|---|---|
| PubChem CID | 70473360 |
| Molecular Formula | C13H16N2O2S3 |
| Molecular Weight | 328.48 g/mol |
| Exact Mass | 328.04 |
| IUPAC Name | ethyl 5-[5-(2-sulfanylidene-3H-1,3,4-thiadiazol-5-yl)thiophen-2-yl]pentanoate |
| SMILES | CCOC(=O)CCCCc1ccc(-c2n[nH]c(=S)s2)s1 |
| InChI | InChI=1S/C13H16N2O2S3/c1-2-17-11(16)6-4-3-5-9-7-8-10(19-9)12-14-15-13(18)20-12/h7-8H,2-6H2,1H3,(H,15,18) |
| InChIKey | FTWPRBHCPKXXGO-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 54.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.48 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|