C11H11IN2O3S — CID 70465429
5-(2-imidazol-1-yl-1-iodoethoxy)-4-methylthiophene-2-carboxylic acid (PubChem CID 70465429) has the molecular formula C11H11IN2O3S and a molecular weight of 378.19 g/mol. Its IUPAC name is 5-(2-imidazol-1-yl-1-iodoethoxy)-4-methylthiophene-2-carboxylic acid.
| Compound Name | 5-(2-imidazol-1-yl-1-iodoethoxy)-4-methylthiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 70465429 |
| Molecular Formula | C11H11IN2O3S |
| Molecular Weight | 378.19 g/mol |
| Exact Mass | 377.95 |
| IUPAC Name | 5-(2-imidazol-1-yl-1-iodoethoxy)-4-methylthiophene-2-carboxylic acid |
| SMILES | Cc1cc(C(=O)O)sc1OC(I)Cn1ccnc1 |
| InChI | InChI=1S/C11H11IN2O3S/c1-7-4-8(10(15)16)18-11(7)17-9(12)5-14-3-2-13-6-14/h2-4,6,9H,5H2,1H3,(H,15,16) |
| InChIKey | BWASPWDLOHKLJA-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.19 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|