C10H10N6S — CID 62244451
[2-(imidazol-1-ylmethyl)thieno[2,3-d]pyrimidin-4-yl]hydrazine (PubChem CID 62244451) has the molecular formula C10H10N6S and a molecular weight of 246.30 g/mol. Its IUPAC name is [2-(imidazol-1-ylmethyl)thieno[2,3-d]pyrimidin-4-yl]hydrazine.
| Compound Name | [2-(imidazol-1-ylmethyl)thieno[2,3-d]pyrimidin-4-yl]hydrazine |
|---|---|
| PubChem CID | 62244451 |
| Molecular Formula | C10H10N6S |
| Molecular Weight | 246.30 g/mol |
| Exact Mass | 246.07 |
| IUPAC Name | [2-(imidazol-1-ylmethyl)thieno[2,3-d]pyrimidin-4-yl]hydrazine |
| SMILES | NNc1nc(Cn2ccnc2)nc2sccc12 |
| InChI | InChI=1S/C10H10N6S/c11-15-9-7-1-4-17-10(7)14-8(13-9)5-16-3-2-12-6-16/h1-4,6H,5,11H2,(H,13,14,15) |
| InChIKey | CMBQQZSYDWRKEZ-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 81.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.30 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|