C14H21N5S — CID 62244605
[2-[(3,5-dimethylpiperidin-1-yl)methyl]thieno[2,3-d]pyrimidin-4-yl]hydrazine (PubChem CID 62244605) has the molecular formula C14H21N5S and a molecular weight of 291.42 g/mol. Its IUPAC name is [2-[(3,5-dimethylpiperidin-1-yl)methyl]thieno[2,3-d]pyrimidin-4-yl]hydrazine.
| Compound Name | [2-[(3,5-dimethylpiperidin-1-yl)methyl]thieno[2,3-d]pyrimidin-4-yl]hydrazine |
|---|---|
| PubChem CID | 62244605 |
| Molecular Formula | C14H21N5S |
| Molecular Weight | 291.42 g/mol |
| Exact Mass | 291.15 |
| IUPAC Name | [2-[(3,5-dimethylpiperidin-1-yl)methyl]thieno[2,3-d]pyrimidin-4-yl]hydrazine |
| SMILES | CC1CC(C)CN(Cc2nc(NN)c3ccsc3n2)C1 |
| InChI | InChI=1S/C14H21N5S/c1-9-5-10(2)7-19(6-9)8-12-16-13(18-15)11-3-4-20-14(11)17-12/h3-4,9-10H,5-8,15H2,1-2H3,(H,16,17,18) |
| InChIKey | KJHYSCLTERYWCG-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 67.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.42 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|