C15H15N5S — CID 62244233
[2-(2,3-dihydroindol-1-ylmethyl)thieno[2,3-d]pyrimidin-4-yl]hydrazine (PubChem CID 62244233) has the molecular formula C15H15N5S and a molecular weight of 297.39 g/mol. Its IUPAC name is [2-(2,3-dihydroindol-1-ylmethyl)thieno[2,3-d]pyrimidin-4-yl]hydrazine.
| Compound Name | [2-(2,3-dihydroindol-1-ylmethyl)thieno[2,3-d]pyrimidin-4-yl]hydrazine |
|---|---|
| PubChem CID | 62244233 |
| Molecular Formula | C15H15N5S |
| Molecular Weight | 297.39 g/mol |
| Exact Mass | 297.10 |
| IUPAC Name | [2-(2,3-dihydroindol-1-ylmethyl)thieno[2,3-d]pyrimidin-4-yl]hydrazine |
| SMILES | NNc1nc(CN2CCc3ccccc32)nc2sccc12 |
| InChI | InChI=1S/C15H15N5S/c16-19-14-11-6-8-21-15(11)18-13(17-14)9-20-7-5-10-3-1-2-4-12(10)20/h1-4,6,8H,5,7,9,16H2,(H,17,18,19) |
| InChIKey | MEQLRRVILXMAMZ-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 67.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.39 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|