C11H14N6OS — CID 62247064
4-[(4-hydrazinylthieno[2,3-d]pyrimidin-2-yl)methyl]piperazin-2-one (PubChem CID 62247064) has the molecular formula C11H14N6OS and a molecular weight of 278.34 g/mol. Its IUPAC name is 4-[(4-hydrazinylthieno[2,3-d]pyrimidin-2-yl)methyl]piperazin-2-one.
| Compound Name | 4-[(4-hydrazinylthieno[2,3-d]pyrimidin-2-yl)methyl]piperazin-2-one |
|---|---|
| PubChem CID | 62247064 |
| Molecular Formula | C11H14N6OS |
| Molecular Weight | 278.34 g/mol |
| Exact Mass | 278.09 |
| IUPAC Name | 4-[(4-hydrazinylthieno[2,3-d]pyrimidin-2-yl)methyl]piperazin-2-one |
| SMILES | NNc1nc(CN2CCNC(=O)C2)nc2sccc12 |
| InChI | InChI=1S/C11H14N6OS/c12-16-10-7-1-4-19-11(7)15-8(14-10)5-17-3-2-13-9(18)6-17/h1,4H,2-3,5-6,12H2,(H,13,18)(H,14,15,16) |
| InChIKey | VHPADEMEDBMKLX-UHFFFAOYSA-N |
| XLogP | -0.09 |
| TPSA | 96.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.34 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|