C14H15ClN4 — CID 62890665
[5-chloro-6-(2,3-dihydroindol-1-ylmethyl)-2-pyridinyl]hydrazine (PubChem CID 62890665) has the molecular formula C14H15ClN4 and a molecular weight of 274.75 g/mol. Its IUPAC name is [5-chloro-6-(2,3-dihydroindol-1-ylmethyl)-2-pyridinyl]hydrazine.
| Compound Name | [5-chloro-6-(2,3-dihydroindol-1-ylmethyl)-2-pyridinyl]hydrazine |
|---|---|
| PubChem CID | 62890665 |
| Molecular Formula | C14H15ClN4 |
| Molecular Weight | 274.75 g/mol |
| Exact Mass | 274.10 |
| IUPAC Name | [5-chloro-6-(2,3-dihydroindol-1-ylmethyl)-2-pyridinyl]hydrazine |
| SMILES | NNc1ccc(Cl)c(CN2CCc3ccccc32)n1 |
| InChI | InChI=1S/C14H15ClN4/c15-11-5-6-14(18-16)17-12(11)9-19-8-7-10-3-1-2-4-13(10)19/h1-6H,7-9,16H2,(H,17,18) |
| InChIKey | SXSQOEHFGZUSGC-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 54.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.75 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|