C11H16N2OS — CID 63770504
8-(1,3-thiazol-4-ylmethyl)-8-azabicyclo[3.2.1]octan-3-ol (PubChem CID 63770504) has the molecular formula C11H16N2OS and a molecular weight of 224.33 g/mol. Its IUPAC name is 8-(1,3-thiazol-4-ylmethyl)-8-azabicyclo[3.2.1]octan-3-ol.
| Compound Name | 8-(1,3-thiazol-4-ylmethyl)-8-azabicyclo[3.2.1]octan-3-ol |
|---|---|
| PubChem CID | 63770504 |
| Molecular Formula | C11H16N2OS |
| Molecular Weight | 224.33 g/mol |
| Exact Mass | 224.10 |
| IUPAC Name | 8-(1,3-thiazol-4-ylmethyl)-8-azabicyclo[3.2.1]octan-3-ol |
| SMILES | OC1CC2CCC(C1)N2Cc1cscn1 |
| InChI | InChI=1S/C11H16N2OS/c14-11-3-9-1-2-10(4-11)13(9)5-8-6-15-7-12-8/h6-7,9-11,14H,1-5H2 |
| InChIKey | PZBPHPROOHXCHI-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 36.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.33 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |