C13H21N3S2 — CID 118790214
4-[1-(1,3-thiazol-4-ylmethyl)piperidin-4-yl]thiomorpholine (PubChem CID 118790214) has the molecular formula C13H21N3S2 and a molecular weight of 283.47 g/mol. Its IUPAC name is 4-[1-(1,3-thiazol-4-ylmethyl)piperidin-4-yl]thiomorpholine.
| Compound Name | 4-[1-(1,3-thiazol-4-ylmethyl)piperidin-4-yl]thiomorpholine |
|---|---|
| PubChem CID | 118790214 |
| Molecular Formula | C13H21N3S2 |
| Molecular Weight | 283.47 g/mol |
| Exact Mass | 283.12 |
| IUPAC Name | 4-[1-(1,3-thiazol-4-ylmethyl)piperidin-4-yl]thiomorpholine |
| SMILES | c1nc(CN2CCC(N3CCSCC3)CC2)cs1 |
| InChI | InChI=1S/C13H21N3S2/c1-3-15(9-12-10-18-11-14-12)4-2-13(1)16-5-7-17-8-6-16/h10-11,13H,1-9H2 |
| InChIKey | DMJGSBIVTXGHCK-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 19.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.47 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |