C11H18N4S — CID 66194828
4-[(3-piperazin-1-ylazetidin-1-yl)methyl]-1,3-thiazole (PubChem CID 66194828) has the molecular formula C11H18N4S and a molecular weight of 238.36 g/mol. Its IUPAC name is 4-[(3-piperazin-1-ylazetidin-1-yl)methyl]-1,3-thiazole.
| Compound Name | 4-[(3-piperazin-1-ylazetidin-1-yl)methyl]-1,3-thiazole |
|---|---|
| PubChem CID | 66194828 |
| Molecular Formula | C11H18N4S |
| Molecular Weight | 238.36 g/mol |
| Exact Mass | 238.13 |
| IUPAC Name | 4-[(3-piperazin-1-ylazetidin-1-yl)methyl]-1,3-thiazole |
| SMILES | c1nc(CN2CC(N3CCNCC3)C2)cs1 |
| InChI | InChI=1S/C11H18N4S/c1-3-15(4-2-12-1)11-6-14(7-11)5-10-8-16-9-13-10/h8-9,11-12H,1-7H2 |
| InChIKey | HJYVQTSKNHJFIQ-UHFFFAOYSA-N |
| XLogP | 0.23 |
| TPSA | 31.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.36 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |