C10H8N2O4S — CID 106903622
6-[(2,4-dioxo-1,3-thiazolidin-3-yl)methyl]pyridine-2-carboxylic acid (PubChem CID 106903622) has the molecular formula C10H8N2O4S and a molecular weight of 252.25 g/mol. Its IUPAC name is 6-[(2,4-dioxo-1,3-thiazolidin-3-yl)methyl]pyridine-2-carboxylic acid.
| Compound Name | 6-[(2,4-dioxo-1,3-thiazolidin-3-yl)methyl]pyridine-2-carboxylic acid |
|---|---|
| PubChem CID | 106903622 |
| Molecular Formula | C10H8N2O4S |
| Molecular Weight | 252.25 g/mol |
| Exact Mass | 252.02 |
| IUPAC Name | 6-[(2,4-dioxo-1,3-thiazolidin-3-yl)methyl]pyridine-2-carboxylic acid |
| SMILES | O=C(O)c1cccc(CN2C(=O)CSC2=O)n1 |
| InChI | InChI=1S/C10H8N2O4S/c13-8-5-17-10(16)12(8)4-6-2-1-3-7(11-6)9(14)15/h1-3H,4-5H2,(H,14,15) |
| InChIKey | XWAWZRJSOKVSTB-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 87.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.25 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|