About 6-[(3,3-dimethyl-2-oxoindol-1-yl)methyl]pyridine-2-carboxylic acid
6-[(3,3-dimethyl-2-oxoindol-1-yl)methyl]pyridine-2-carboxylic acid (PubChem CID 178053194) has the molecular formula C17H16N2O3
and a molecular weight of 296.33 g/mol. Its IUPAC name is 6-[(3,3-dimethyl-2-oxoindol-1-yl)methyl]pyridine-2-carboxylic acid.
Molecular Properties
| Compound Name | 6-[(3,3-dimethyl-2-oxoindol-1-yl)methyl]pyridine-2-carboxylic acid |
| PubChem CID | 178053194 |
| Molecular Formula | C17H16N2O3 |
| Molecular Weight | 296.33 g/mol |
| Exact Mass | 296.12 |
| IUPAC Name | 6-[(3,3-dimethyl-2-oxoindol-1-yl)methyl]pyridine-2-carboxylic acid |
| SMILES | CC1(C)C(=O)N(Cc2cccc(C(=O)O)n2)c2ccccc21 |
| InChI | InChI=1S/C17H16N2O3/c1-17(2)12-7-3-4-9-14(12)19(16(17)22)10-11-6-5-8-13(18-11)15(20)21/h3-9H,10H2,1-2H3,(H,20,21) |
| InChIKey | NLJAVZGKSDCXIX-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 70.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 296.33 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6-[(3,3-dimethyl-2-oxoindol-1-yl)methyl]pyridine-2-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[(3,3-dimethyl-2-oxoindol-1-yl)methyl]pyridine-2-carboxylic acid?
The IUPAC name of 6-[(3,3-dimethyl-2-oxoindol-1-yl)methyl]pyridine-2-carboxylic acid (CID 178053194) is 6-[(3,3-dimethyl-2-oxoindol-1-yl)methyl]pyridine-2-carboxylic acid.
What is the SMILES notation for 6-[(3,3-dimethyl-2-oxoindol-1-yl)methyl]pyridine-2-carboxylic acid?
The canonical SMILES for 6-[(3,3-dimethyl-2-oxoindol-1-yl)methyl]pyridine-2-carboxylic acid is CC1(C)C(=O)N(Cc2cccc(C(=O)O)n2)c2ccccc21.
What is the InChIKey of 6-[(3,3-dimethyl-2-oxoindol-1-yl)methyl]pyridine-2-carboxylic acid?
The InChIKey is NLJAVZGKSDCXIX-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H16N2O3/c1-17(2)12-7-3-4-9-14(12)19(16(17)22)10-11-6-5-8-13(18-11)15(20)21/h3-9H,10H2,1-2H3,(H,20,21).
What are the key properties of 6-[(3,3-dimethyl-2-oxoindol-1-yl)methyl]pyridine-2-carboxylic acid?
6-[(3,3-dimethyl-2-oxoindol-1-yl)methyl]pyridine-2-carboxylic acid has a molecular weight of 296.33 g/mol, XLogP of 2.60, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[(3,3-dimethyl-2-oxoindol-1-yl)methyl]pyridine-2-carboxylic acid is sourced from PubChem (CID 178053194), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).