C14H15NO4S — CID 84616109
methyl 4-(7-formyl-3-oxo-1,4-benzothiazin-4-yl)butanoate (PubChem CID 84616109) has the molecular formula C14H15NO4S and a molecular weight of 293.34 g/mol. Its IUPAC name is methyl 4-(7-formyl-3-oxo-1,4-benzothiazin-4-yl)butanoate.
| Compound Name | methyl 4-(7-formyl-3-oxo-1,4-benzothiazin-4-yl)butanoate |
|---|---|
| PubChem CID | 84616109 |
| Molecular Formula | C14H15NO4S |
| Molecular Weight | 293.34 g/mol |
| Exact Mass | 293.07 |
| IUPAC Name | methyl 4-(7-formyl-3-oxo-1,4-benzothiazin-4-yl)butanoate |
| SMILES | COC(=O)CCCN1C(=O)CSc2cc(C=O)ccc21 |
| InChI | InChI=1S/C14H15NO4S/c1-19-14(18)3-2-6-15-11-5-4-10(8-16)7-12(11)20-9-13(15)17/h4-5,7-8H,2-3,6,9H2,1H3 |
| InChIKey | IUBCYOKLUXABSL-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.34 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|