C12H14N2O3S — CID 115232222
methyl 3-(6-amino-3-oxo-1,4-benzothiazin-4-yl)propanoate (PubChem CID 115232222) has the molecular formula C12H14N2O3S and a molecular weight of 266.32 g/mol. Its IUPAC name is methyl 3-(6-amino-3-oxo-1,4-benzothiazin-4-yl)propanoate.
| Compound Name | methyl 3-(6-amino-3-oxo-1,4-benzothiazin-4-yl)propanoate |
|---|---|
| PubChem CID | 115232222 |
| Molecular Formula | C12H14N2O3S |
| Molecular Weight | 266.32 g/mol |
| Exact Mass | 266.07 |
| IUPAC Name | methyl 3-(6-amino-3-oxo-1,4-benzothiazin-4-yl)propanoate |
| SMILES | COC(=O)CCN1C(=O)CSc2ccc(N)cc21 |
| InChI | InChI=1S/C12H14N2O3S/c1-17-12(16)4-5-14-9-6-8(13)2-3-10(9)18-7-11(14)15/h2-3,6H,4-5,7,13H2,1H3 |
| InChIKey | ONWGTWBLQFEFSL-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 72.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.32 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|