C14H17NO3S — CID 84614731
6-(1-hydroxyethyl)-4-(3-oxobutyl)-1,4-benzothiazin-3-one (PubChem CID 84614731) has the molecular formula C14H17NO3S and a molecular weight of 279.36 g/mol. Its IUPAC name is 6-(1-hydroxyethyl)-4-(3-oxobutyl)-1,4-benzothiazin-3-one.
| Compound Name | 6-(1-hydroxyethyl)-4-(3-oxobutyl)-1,4-benzothiazin-3-one |
|---|---|
| PubChem CID | 84614731 |
| Molecular Formula | C14H17NO3S |
| Molecular Weight | 279.36 g/mol |
| Exact Mass | 279.09 |
| IUPAC Name | 6-(1-hydroxyethyl)-4-(3-oxobutyl)-1,4-benzothiazin-3-one |
| SMILES | CC(=O)CCN1C(=O)CSc2ccc(C(C)O)cc21 |
| InChI | InChI=1S/C14H17NO3S/c1-9(16)5-6-15-12-7-11(10(2)17)3-4-13(12)19-8-14(15)18/h3-4,7,10,17H,5-6,8H2,1-2H3 |
| InChIKey | XKAQYEPPSPOPFI-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.36 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |