C13H13NO4S — CID 84616152
4-(6-formyl-3-oxo-1,4-benzothiazin-4-yl)butanoic acid (PubChem CID 84616152) has the molecular formula C13H13NO4S and a molecular weight of 279.32 g/mol. Its IUPAC name is 4-(6-formyl-3-oxo-1,4-benzothiazin-4-yl)butanoic acid.
| Compound Name | 4-(6-formyl-3-oxo-1,4-benzothiazin-4-yl)butanoic acid |
|---|---|
| PubChem CID | 84616152 |
| Molecular Formula | C13H13NO4S |
| Molecular Weight | 279.32 g/mol |
| Exact Mass | 279.06 |
| IUPAC Name | 4-(6-formyl-3-oxo-1,4-benzothiazin-4-yl)butanoic acid |
| SMILES | O=Cc1ccc2c(c1)N(CCCC(=O)O)C(=O)CS2 |
| InChI | InChI=1S/C13H13NO4S/c15-7-9-3-4-11-10(6-9)14(12(16)8-19-11)5-1-2-13(17)18/h3-4,6-7H,1-2,5,8H2,(H,17,18) |
| InChIKey | FCRLOIUWVSGBCR-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.32 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|