C16H21NO3S — CID 10757135
ethyl 3-oxo-4-pentyl-1,4-benzothiazine-6-carboxylate (PubChem CID 10757135) has the molecular formula C16H21NO3S and a molecular weight of 307.42 g/mol. Its IUPAC name is ethyl 3-oxo-4-pentyl-1,4-benzothiazine-6-carboxylate.
| Compound Name | ethyl 3-oxo-4-pentyl-1,4-benzothiazine-6-carboxylate |
|---|---|
| PubChem CID | 10757135 |
| Molecular Formula | C16H21NO3S |
| Molecular Weight | 307.42 g/mol |
| Exact Mass | 307.12 |
| IUPAC Name | ethyl 3-oxo-4-pentyl-1,4-benzothiazine-6-carboxylate |
| SMILES | CCCCCN1C(=O)CSc2ccc(C(=O)OCC)cc21 |
| InChI | InChI=1S/C16H21NO3S/c1-3-5-6-9-17-13-10-12(16(19)20-4-2)7-8-14(13)21-11-15(17)18/h7-8,10H,3-6,9,11H2,1-2H3 |
| InChIKey | AXQLMTUXASCXDZ-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.42 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|