C27H36N2O2S — CID 11080916
N-butyl-N-(4-octyl-3-oxo-1,4-benzothiazin-6-yl)benzamide (PubChem CID 11080916) has the molecular formula C27H36N2O2S and a molecular weight of 452.66 g/mol. Its IUPAC name is N-butyl-N-(4-octyl-3-oxo-1,4-benzothiazin-6-yl)benzamide.
| Compound Name | N-butyl-N-(4-octyl-3-oxo-1,4-benzothiazin-6-yl)benzamide |
|---|---|
| PubChem CID | 11080916 |
| Molecular Formula | C27H36N2O2S |
| Molecular Weight | 452.66 g/mol |
| Exact Mass | 452.25 |
| IUPAC Name | N-butyl-N-(4-octyl-3-oxo-1,4-benzothiazin-6-yl)benzamide |
| SMILES | CCCCCCCCN1C(=O)CSc2ccc(N(CCCC)C(=O)c3ccccc3)cc21 |
| InChI | InChI=1S/C27H36N2O2S/c1-3-5-7-8-9-13-19-29-24-20-23(16-17-25(24)32-21-26(29)30)28(18-6-4-2)27(31)22-14-11-10-12-15-22/h10-12,14-17,20H,3-9,13,18-19,21H2,1-2H3 |
| InChIKey | JCSHHGPVFQTIAP-UHFFFAOYSA-N |
| XLogP | 6.93 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.66 |
| LogP ≤ 5 | 6.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|