C23H37N3O4S2 — CID 46372472
2-[6-(dipropylsulfamoyl)-3-oxo-1,4-benzothiazin-4-yl]-N-heptylacetamide (PubChem CID 46372472) has the molecular formula C23H37N3O4S2 and a molecular weight of 483.70 g/mol. Its IUPAC name is 2-[6-(dipropylsulfamoyl)-3-oxo-1,4-benzothiazin-4-yl]-N-heptylacetamide.
| Compound Name | 2-[6-(dipropylsulfamoyl)-3-oxo-1,4-benzothiazin-4-yl]-N-heptylacetamide |
|---|---|
| PubChem CID | 46372472 |
| Molecular Formula | C23H37N3O4S2 |
| Molecular Weight | 483.70 g/mol |
| Exact Mass | 483.22 |
| IUPAC Name | 2-[6-(dipropylsulfamoyl)-3-oxo-1,4-benzothiazin-4-yl]-N-heptylacetamide |
| SMILES | CCCCCCCNC(=O)CN1C(=O)CSc2ccc(S(=O)(=O)N(CCC)CCC)cc21 |
| InChI | InChI=1S/C23H37N3O4S2/c1-4-7-8-9-10-13-24-22(27)17-26-20-16-19(11-12-21(20)31-18-23(26)28)32(29,30)25(14-5-2)15-6-3/h11-12,16H,4-10,13-15,17-18H2,1-3H3,(H,24,27) |
| InChIKey | YTZQUIXQRVCQTM-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.70 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|