C24H40N2OS — CID 10949499
4-octyl-6-(octylamino)-1,4-benzothiazin-3-one (PubChem CID 10949499) has the molecular formula C24H40N2OS and a molecular weight of 404.66 g/mol. Its IUPAC name is 4-octyl-6-(octylamino)-1,4-benzothiazin-3-one.
| Compound Name | 4-octyl-6-(octylamino)-1,4-benzothiazin-3-one |
|---|---|
| PubChem CID | 10949499 |
| Molecular Formula | C24H40N2OS |
| Molecular Weight | 404.66 g/mol |
| Exact Mass | 404.29 |
| IUPAC Name | 4-octyl-6-(octylamino)-1,4-benzothiazin-3-one |
| SMILES | CCCCCCCCNc1ccc2c(c1)N(CCCCCCCC)C(=O)CS2 |
| InChI | InChI=1S/C24H40N2OS/c1-3-5-7-9-11-13-17-25-21-15-16-23-22(19-21)26(24(27)20-28-23)18-14-12-10-8-6-4-2/h15-16,19,25H,3-14,17-18,20H2,1-2H3 |
| InChIKey | PCNIJPPHQVZHEX-UHFFFAOYSA-N |
| XLogP | 7.26 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.66 |
| LogP ≤ 5 | 7.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|