C16H24N2OS — CID 43723115
6-(octylamino)-4H-1,4-benzothiazin-3-one (PubChem CID 43723115) has the molecular formula C16H24N2OS and a molecular weight of 292.45 g/mol. Its IUPAC name is 6-(octylamino)-4H-1,4-benzothiazin-3-one.
| Compound Name | 6-(octylamino)-4H-1,4-benzothiazin-3-one |
|---|---|
| PubChem CID | 43723115 |
| Molecular Formula | C16H24N2OS |
| Molecular Weight | 292.45 g/mol |
| Exact Mass | 292.16 |
| IUPAC Name | 6-(octylamino)-4H-1,4-benzothiazin-3-one |
| SMILES | CCCCCCCCNc1ccc2c(c1)NC(=O)CS2 |
| InChI | InChI=1S/C16H24N2OS/c1-2-3-4-5-6-7-10-17-13-8-9-15-14(11-13)18-16(19)12-20-15/h8-9,11,17H,2-7,10,12H2,1H3,(H,18,19) |
| InChIKey | QQFZZBDZZNIRLQ-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.45 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|