C15H12F2N2OS — CID 103851322
6-[(3,5-difluorophenyl)methylamino]-4H-1,4-benzothiazin-3-one (PubChem CID 103851322) has the molecular formula C15H12F2N2OS and a molecular weight of 306.34 g/mol. Its IUPAC name is 6-[(3,5-difluorophenyl)methylamino]-4H-1,4-benzothiazin-3-one.
| Compound Name | 6-[(3,5-difluorophenyl)methylamino]-4H-1,4-benzothiazin-3-one |
|---|---|
| PubChem CID | 103851322 |
| Molecular Formula | C15H12F2N2OS |
| Molecular Weight | 306.34 g/mol |
| Exact Mass | 306.06 |
| IUPAC Name | 6-[(3,5-difluorophenyl)methylamino]-4H-1,4-benzothiazin-3-one |
| SMILES | O=C1CSc2ccc(NCc3cc(F)cc(F)c3)cc2N1 |
| InChI | InChI=1S/C15H12F2N2OS/c16-10-3-9(4-11(17)5-10)7-18-12-1-2-14-13(6-12)19-15(20)8-21-14/h1-6,18H,7-8H2,(H,19,20) |
| InChIKey | ZUFJITUVSSRQIS-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.34 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |