C13H17N3OS — CID 115206766
6-[2-(cyclopropylamino)ethylamino]-4H-1,4-benzothiazin-3-one (PubChem CID 115206766) has the molecular formula C13H17N3OS and a molecular weight of 263.37 g/mol. Its IUPAC name is 6-[2-(cyclopropylamino)ethylamino]-4H-1,4-benzothiazin-3-one.
| Compound Name | 6-[2-(cyclopropylamino)ethylamino]-4H-1,4-benzothiazin-3-one |
|---|---|
| PubChem CID | 115206766 |
| Molecular Formula | C13H17N3OS |
| Molecular Weight | 263.37 g/mol |
| Exact Mass | 263.11 |
| IUPAC Name | 6-[2-(cyclopropylamino)ethylamino]-4H-1,4-benzothiazin-3-one |
| SMILES | O=C1CSc2ccc(NCCNC3CC3)cc2N1 |
| InChI | InChI=1S/C13H17N3OS/c17-13-8-18-12-4-3-10(7-11(12)16-13)15-6-5-14-9-1-2-9/h3-4,7,9,14-15H,1-2,5-6,8H2,(H,16,17) |
| InChIKey | TWMDSSPFGOINHW-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 53.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.37 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|