C18H27NO4S — CID 143729471
ethane;ethyl 4-(4-methoxybutyl)-3-oxo-1,4-benzothiazine-6-carboxylate (PubChem CID 143729471) has the molecular formula C18H27NO4S and a molecular weight of 353.48 g/mol. Its IUPAC name is ethane;ethyl 4-(4-methoxybutyl)-3-oxo-1,4-benzothiazine-6-carboxylate.
| Compound Name | ethane;ethyl 4-(4-methoxybutyl)-3-oxo-1,4-benzothiazine-6-carboxylate |
|---|---|
| PubChem CID | 143729471 |
| Molecular Formula | C18H27NO4S |
| Molecular Weight | 353.48 g/mol |
| Exact Mass | 353.17 |
| IUPAC Name | ethane;ethyl 4-(4-methoxybutyl)-3-oxo-1,4-benzothiazine-6-carboxylate |
| SMILES | CC.CCOC(=O)c1ccc2c(c1)N(CCCCOC)C(=O)CS2 |
| InChI | InChI=1S/C16H21NO4S.C2H6/c1-3-21-16(19)12-6-7-14-13(10-12)17(15(18)11-22-14)8-4-5-9-20-2;1-2/h6-7,10H,3-5,8-9,11H2,1-2H3;1-2H3 |
| InChIKey | XRJFKCBAJHKUAY-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.48 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|